Products 433315-09-4

CAS 433315-09-4 is the registry number for 2-((4-(N-(4-Ethoxyphenyl)sulfamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 433315-09-4) is a chemical compound with the molecular formula C22H20N2O6S and a molecular weight of 440.5 g/mol. IUPAC name: 2-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: QJNBLRYJUOLEHU-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20N2O6S
Molecular weight440.5 g/mol
IUPAC name2-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyQJNBLRYJUOLEHU-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)