Products 433316-83-7

CAS 433316-83-7 is the registry number for 4-((4-(N-(4-Iodophenyl)sulfamoyl)phenyl)amino)-4-oxobut-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4-[(4-iodophenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid (CAS 433316-83-7) is a chemical compound with the molecular formula C16H13IN2O5S and a molecular weight of 472.3 g/mol. IUPAC name: 4-[4-[(4-iodophenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid. InChIKey: PULBWEGDXPAKFU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13IN2O5S
Molecular weight472.3 g/mol
IUPAC name4-[4-[(4-iodophenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid
InChIKeyPULBWEGDXPAKFU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)C=CC(=O)O)S(=O)(=O)NC2=CC=C(C=C2)I

Computed by PubChem (NCBI)