CAS 433337-11-2 appears in our catalog under these names: 1-Benzyl-3-methylimidazolium Hexafluorophosphate, >98.0%(HPLC)(N), 1-Benzyl-3-methylimidazolium hexafluorophosphate, 98%, 98%, 1-Benzyl-3-methylimidazolium hexafluorophosphate, 97%+(HPLC),RG, 1-Benzyl-3-methylimidazolium hexafluorophosphate, 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 100g, 50g.
1-benzyl-3-methylimidazol-3-ium hexafluorophosphate (CAS 433337-11-2) is a chemical compound with the molecular formula C11H13F6N2P and a molecular weight of 318.20 g/mol. IUPAC name: 1-benzyl-3-methylimidazol-3-ium hexafluorophosphate. InChIKey: VVCQOUQQPZPIKL-UHFFFAOYSA-N.
| Molecular formula | C11H13F6N2P |
|---|---|
| Molecular weight | 318.20 g/mol |
| IUPAC name | 1-benzyl-3-methylimidazol-3-ium hexafluorophosphate |
| InChIKey | VVCQOUQQPZPIKL-UHFFFAOYSA-N |
| SMILES | C[N+]1=CN(C=C1)CC2=CC=CC=C2.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)