CAS 434-64-0 appears in our catalog under these names: Octafluorotoluene, 95%, Octafluorotoluene, Octafluorotoluene, 98+% , Octafluorotoluene, >98.0%(GC), Octafluorotoluene 98%. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 100g, 5g, 100mg, 500mg, 50mg, 500g.
1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene (CAS 434-64-0) is a chemical compound with the molecular formula C7F8 and a molecular weight of 236.06 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene. InChIKey: USPWUOFNOTUBAD-UHFFFAOYSA-N.
| Molecular formula | C7F8 |
|---|---|
| Molecular weight | 236.06 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene |
| InChIKey | USPWUOFNOTUBAD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)