CAS 434-85-5 appears in our catalog under these names: Bianthrone, 97%, Bianthrone/ 98.8% (existing batch purity), Bianthrone, Bianthrone, >95.0%(HPLC), 10H,10'H-[9,9'-Bianthracenylidene]-10,10'-dione, ≥95.0%(HPLC), ≥95.0%(HPLC). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 50mg, 100mg, 250mg.
10-(10-oxoanthracen-9-ylidene)anthracen-9-one (CAS 434-85-5) is a chemical compound with the molecular formula C28H16O2 and a molecular weight of 384.4 g/mol. IUPAC name: 10-(10-oxoanthracen-9-ylidene)anthracen-9-one. InChIKey: MGRRGKWPEVFJSH-UHFFFAOYSA-N.
| Molecular formula | C28H16O2 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 10-(10-oxoanthracen-9-ylidene)anthracen-9-one |
| InChIKey | MGRRGKWPEVFJSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C4=CC=CC=C4C(=O)C5=CC=CC=C53)C6=CC=CC=C6C2=O |
Computed by PubChem (NCBI)