Products 4342-40-9
CAS 4342-40-9 appears in our catalog under these names: Hexamethylbenzene-d18, >95% (HPLC), Hexamethylbenzene-d18, 98 atom % D, min 98% Chemical Purity, HEXAMETHYLBENZENE–D18, Hexamethylbenzene-d18, 99.47%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 1g, 10mg, 25mg, 25 mg, 10 mg.
1,2,3,4,5,6-hexakis(trideuteriomethyl)benzene (CAS 4342-40-9) is a chemical compound with the molecular formula C12H18 and a molecular weight of 180.38 g/mol. IUPAC name: 1,2,3,4,5,6-hexakis(trideuteriomethyl)benzene. InChIKey: YUWFEBAXEOLKSG-NBDUPMGQSA-N.
| Molecular formula | C12H18 |
|---|---|
| Molecular weight | 180.38 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexakis(trideuteriomethyl)benzene |
| InChIKey | YUWFEBAXEOLKSG-NBDUPMGQSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=C(C(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)