Products 434349-93-6
CAS 434349-93-6 appears in our catalog under these names: Methyl Tetradecanoate-d27, Methyl Tetradecanoate-d27, 98 atom % D, min 98% Chemical Purity, Myristic Acid methyl ester–d27, Methyl tetradecanoate-d27, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,1g, 25mg, 10 mg, 50 mg.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate (CAS 434349-93-6) is a chemical compound with the molecular formula C15H30O2 and a molecular weight of 269.56 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate. InChIKey: ZAZKJZBWRNNLDS-NFTMZUINSA-N.
| Molecular formula | C15H30O2 |
|---|---|
| Molecular weight | 269.56 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate |
| InChIKey | ZAZKJZBWRNNLDS-NFTMZUINSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Myristic Acid methyl ester-d27