CAS 4345-46-4 appears in our catalog under these names: 3,5-Dimethyl-4-phenylisoxazole, 3,5-Dimethyl-4-phenyl-1,2-oxazole, 3,5-Dimethyl-4-phenyl-1,2-oxazole, 95%, 3,5-dimethyl-4-phenyl-1,2-oxazole/ 95%. Offered by: MedChemExpress, Biosynth, Chemat, AmBeed, TargetMol. Available pack sizes: 50 mg, 10 mg, 1 mg, 25 mg, 5 mg, 0,5g, 50mg, 1mg.
3,5-dimethyl-4-phenyl-1,2-oxazole (CAS 4345-46-4) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 3,5-dimethyl-4-phenyl-1,2-oxazole. InChIKey: BHAXDAUULXCVEK-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 3,5-dimethyl-4-phenyl-1,2-oxazole |
| InChIKey | BHAXDAUULXCVEK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)