CAS 4349-41-1 appears in our catalog under these names: Folinic Acid Impurity 1, Folinic Acid Impurity 8, Folic Acid Impurity 31, 5-Methyltetrahydropteroic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoic acid (CAS 4349-41-1) is a chemical compound with the molecular formula C15H18N6O3 and a molecular weight of 330.34 g/mol. IUPAC name: 4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoic acid. InChIKey: OCWWMSJBVHBZEF-UHFFFAOYSA-N.
| Molecular formula | C15H18N6O3 |
|---|---|
| Molecular weight | 330.34 g/mol |
| IUPAC name | 4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoic acid |
| InChIKey | OCWWMSJBVHBZEF-UHFFFAOYSA-N |
| SMILES | CN1C(CNC2=C1C(=O)NC(=N2)N)CNC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)