CAS 434935-69-0 appears in our catalog under these names: 2-Methyl-6-nitrobenzoic anhydride, 97%, 2–Methyl–6–nitrobenzoic anhydride, 2-Methyl-6-nitrobenzoic Anhydride, >98.0%(T), 2-Methyl-6-nitrobenzoic anhydride 97%, 2-Methyl-6-Nitrobenzoic Anhydride, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 250mg, 100mg, 50g.
(2-methyl-6-nitrobenzoyl) 2-methyl-6-nitrobenzoate (CAS 434935-69-0) is a chemical compound with the molecular formula C16H12N2O7 and a molecular weight of 344.27 g/mol. IUPAC name: (2-methyl-6-nitrobenzoyl) 2-methyl-6-nitrobenzoate. InChIKey: YEKPNMQQSPHKBP-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O7 |
|---|---|
| Molecular weight | 344.27 g/mol |
| IUPAC name | (2-methyl-6-nitrobenzoyl) 2-methyl-6-nitrobenzoate |
| InChIKey | YEKPNMQQSPHKBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])C(=O)OC(=O)C2=C(C=CC=C2[N+](=O)[O-])C |
Computed by PubChem (NCBI)