CAS 435-08-5 appears in our catalog under these names: 1,1,2,2-Tetrakis(4-fluorophenyl)ethene 98%, 1,1,2,2-Tetrakis(4-fluorophenyl)ethene, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethenyl]benzene (CAS 435-08-5) is a chemical compound with the molecular formula C26H16F4 and a molecular weight of 404.4 g/mol. IUPAC name: 1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethenyl]benzene. InChIKey: LXTWRLICBHFDFV-UHFFFAOYSA-N.
| Molecular formula | C26H16F4 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethenyl]benzene |
| InChIKey | LXTWRLICBHFDFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)F |
Computed by PubChem (NCBI)