CAS 435327-40-5 appears in our catalog under these names: Avasopasem manganese, Avasopasem manganese, Avasopasem manganese, 96%, 96%, Avasopasem manganese, 96.07%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 100 mg, 25 mg.
Dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene (CAS 435327-40-5) is a chemical compound with the molecular formula C21H35Cl2MnN5 and a molecular weight of 483.4 g/mol. IUPAC name: dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene. InChIKey: WXEMWBBXVXHEPU-NDOCQCNASA-L.
| Molecular formula | C21H35Cl2MnN5 |
|---|---|
| Molecular weight | 483.4 g/mol |
| IUPAC name | dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
| InChIKey | WXEMWBBXVXHEPU-NDOCQCNASA-L |
| SMILES | C1CC[C@H]2[C@H](C1)NCCN[C@H]3CCCC[C@@H]3NCC4=CC=CC(=N4)CN2.Cl[Mn]Cl |
Computed by PubChem (NCBI)