CAS 435342-02-2 is the registry number for 1-{1H-Naphtho(2,3-d)imidazol-2-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1H-benzo[f]benzimidazol-2-ylmethanamine (CAS 435342-02-2) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: 1H-benzo[f]benzimidazol-2-ylmethanamine. InChIKey: AJKYFNXDRVSPJH-UHFFFAOYSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | 1H-benzo[f]benzimidazol-2-ylmethanamine |
| InChIKey | AJKYFNXDRVSPJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)NC(=N3)CN |
Computed by PubChem (NCBI)