CAS 4356-83-6 appears in our catalog under these names: Methyl 2,3,4-Tri-O-benzyl-Beta-D-glucuronic Acid, Benzyl Ester, Methyl 2,3,4-tri-O-benzyl-b-D-glucuronide benzyl ester. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
Benzyl (2S,3S,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate (CAS 4356-83-6) is a chemical compound with the molecular formula C35H36O7 and a molecular weight of 568.7 g/mol. IUPAC name: benzyl (2S,3S,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate. InChIKey: ZSBAMJXOTVTRDC-MNYCWKMRSA-N.
| Molecular formula | C35H36O7 |
|---|---|
| Molecular weight | 568.7 g/mol |
| IUPAC name | benzyl (2S,3S,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
| InChIKey | ZSBAMJXOTVTRDC-MNYCWKMRSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)