CAS 436-59-9 appears in our catalog under these names: fluorobis(2,4,6-trimethylphenyl)borane, 98%, Fluorodimesitylborane, Dimesitylfluoroborane, >98.0%(HPLC), Fluorodimesitylborane 97%, DIMESITYLBORON FLUORIDE, 90%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg, 15g.
Fluoro-bis(2,4,6-trimethylphenyl)borane (CAS 436-59-9) is a chemical compound with the molecular formula C18H22BF and a molecular weight of 268.2 g/mol. IUPAC name: fluoro-bis(2,4,6-trimethylphenyl)borane. InChIKey: WZWGERGANZMXOM-UHFFFAOYSA-N.
| Molecular formula | C18H22BF |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | fluoro-bis(2,4,6-trimethylphenyl)borane |
| InChIKey | WZWGERGANZMXOM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(C2=C(C=C(C=C2C)C)C)F |
Computed by PubChem (NCBI)