CAS 437-25-2 appears in our catalog under these names: 4-Fluoro-n,n-diphenylbenzenamine, 95%, 4–Fluoro–N,N–diphenylaniline, 4-Fluoro-N,N-diphenylaniline, >98.0%(GC), 4-Fluoro-N,N-diphenylaniline 99%, 4-Fluoro-N,N-Diphenylbenzenamine, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
4-fluoro-N,N-diphenylaniline (CAS 437-25-2) is a chemical compound with the molecular formula C18H14FN and a molecular weight of 263.3 g/mol. IUPAC name: 4-fluoro-N,N-diphenylaniline. InChIKey: LQDQVCOHANBTIC-UHFFFAOYSA-N.
| Molecular formula | C18H14FN |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 4-fluoro-N,N-diphenylaniline |
| InChIKey | LQDQVCOHANBTIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)