CAS 4371-28-2 appears in our catalog under these names: (1,1'–Biphenyl)–3,3',5,5'–tetracarboxylic acid, Biphenyl-3,3',5,5'-tetracarboxylic acid, Biphenyl-3,3',5,5'-tetracarboxylic Acid, >98.0%(HPLC), [1,1'-Biphenyl]-3,3',5,5'-tetracarboxylic acid 95%, [1,1'-Biphenyl]-3,3',5,5'-tetracarboxylic acid, 95%. Offered by: GLPBio, Thermo Scientific (Acros), TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100MG, 200mg, 25g, 100g.
5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 4371-28-2) is a chemical compound with the molecular formula C16H10O8 and a molecular weight of 330.24 g/mol. IUPAC name: 5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: QURGMSIQFRADOZ-UHFFFAOYSA-N.
| Molecular formula | C16H10O8 |
|---|---|
| Molecular weight | 330.24 g/mol |
| IUPAC name | 5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | QURGMSIQFRADOZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)