Products 437655-96-4
CAS 437655-96-4 appears in our catalog under these names: Fmoc–NH–PEG6–CH2COOH, Fmoc-NH-PEG6-CH2COOH, 99.85%, Fmoc-NH-PEG6-CH2COOH, 95%, 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22-heptaoxa-4-azatetracosan-24-oic acid, 95%, Fmoc-NH-PEG6-CH2COOH, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 250 mg, 10 g, 100 mg, 5 g, 1 g, 1g.
2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 437655-96-4) is a chemical compound with the molecular formula C29H39NO10 and a molecular weight of 561.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: HANLHKUCDRJGKX-UHFFFAOYSA-N.
| Molecular formula | C29H39NO10 |
|---|---|
| Molecular weight | 561.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | HANLHKUCDRJGKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)