CAS 437701-79-6 appears in our catalog under these names: 1,2,3,4,5-Pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene, PBDE No. 207. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 50mg, 5mg, 10mg.
1,2,3,4,5-pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene (CAS 437701-79-6) is a chemical compound with the molecular formula C12HBr9O and a molecular weight of 880.3 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene. InChIKey: IEEVDIAVLGLVOW-UHFFFAOYSA-N.
| Molecular formula | C12HBr9O |
|---|---|
| Molecular weight | 880.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene |
| InChIKey | IEEVDIAVLGLVOW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)