CAS 437708-86-6 appears in our catalog under these names: 2,4–Dibromo–6–nitroquinoline, 2,4-Dibromo-6-nitroquinoline 97%, 2,4-Dibromo-6-nitroquinoline, 97%, 2,4-Dibromo-6-nitroquinoline, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dibromo-6-nitroquinoline (CAS 437708-86-6) is a chemical compound with the molecular formula C9H4Br2N2O2 and a molecular weight of 331.95 g/mol. IUPAC name: 2,4-dibromo-6-nitroquinoline. InChIKey: OQHTYRLFDROPPJ-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2N2O2 |
|---|---|
| Molecular weight | 331.95 g/mol |
| IUPAC name | 2,4-dibromo-6-nitroquinoline |
| InChIKey | OQHTYRLFDROPPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CC(=N2)Br)Br |
Computed by PubChem (NCBI)