CAS 437711-24-5 appears in our catalog under these names: 1-(2-Chlorophenyl)-5-(furan-2-yl)-3-(trifluoromethyl)-1H-pyrazole, 97%, 97%, 1-(2-Chloro-phenyl)-5-furan-2-yl-3-trifluoromethyl-1H-pyrazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2-chlorophenyl)-5-(furan-2-yl)-3-(trifluoromethyl)pyrazole (CAS 437711-24-5) is a chemical compound with the molecular formula C14H8ClF3N2O and a molecular weight of 312.67 g/mol. IUPAC name: 1-(2-chlorophenyl)-5-(furan-2-yl)-3-(trifluoromethyl)pyrazole. InChIKey: NZEULIMFQVSHMZ-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N2O |
|---|---|
| Molecular weight | 312.67 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-5-(furan-2-yl)-3-(trifluoromethyl)pyrazole |
| InChIKey | NZEULIMFQVSHMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=CC(=N2)C(F)(F)F)C3=CC=CO3)Cl |
Computed by PubChem (NCBI)