CAS 437713-06-9 is the registry number for Atazanavir Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-amino-1-[amino-[(4-pyridin-2-ylphenyl)methyl]amino]-4-phenylbutan-2-ol (CAS 437713-06-9) is a chemical compound with the molecular formula C22H26N4O and a molecular weight of 362.5 g/mol. IUPAC name: (2S,3S)-3-amino-1-[amino-[(4-pyridin-2-ylphenyl)methyl]amino]-4-phenylbutan-2-ol. InChIKey: BBMPHERXUYPXDO-UNMCSNQZSA-N.
| Molecular formula | C22H26N4O |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | (2S,3S)-3-amino-1-[amino-[(4-pyridin-2-ylphenyl)methyl]amino]-4-phenylbutan-2-ol |
| InChIKey | BBMPHERXUYPXDO-UNMCSNQZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([C@H](CN(CC2=CC=C(C=C2)C3=CC=CC=N3)N)O)N |
Computed by PubChem (NCBI)