CAS 437981-33-4 is the registry number for 2,2',2''-(Benzene-1,3,5-triyl)tris(2-phenoxyacetaldehyde), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3,5-bis(2-oxo-1-phenoxyethyl)phenyl]-2-phenoxyacetaldehyde (CAS 437981-33-4) is a chemical compound with the molecular formula C30H24O6 and a molecular weight of 480.5 g/mol. IUPAC name: 2-[3,5-bis(2-oxo-1-phenoxyethyl)phenyl]-2-phenoxyacetaldehyde. InChIKey: ABLGISRFGRXNOQ-UHFFFAOYSA-N.
| Molecular formula | C30H24O6 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | 2-[3,5-bis(2-oxo-1-phenoxyethyl)phenyl]-2-phenoxyacetaldehyde |
| InChIKey | ABLGISRFGRXNOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(C=O)C2=CC(=CC(=C2)C(C=O)OC3=CC=CC=C3)C(C=O)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)