CAS 438-22-2 appears in our catalog under these names: 5alpha-Androstane, 5α-Androstane, Androstane, 5A-ANDROSTANE. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 500mg, 1G.
5alpha-androstane is the 5alpha-stereoisomer of androstane. It has a role as a human metabolite.
Source: ChEBI
| Molecular formula | C19H32 |
|---|---|
| Molecular weight | 260.5 g/mol |
| IUPAC name | (5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| InChIKey | QZLYKIGBANMMBK-UGCZWRCOSA-N |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]3CC[C@H]4CCCC[C@@]4([C@H]3CC2)C |
Computed by PubChem (NCBI)