CAS 438018-70-3 appears in our catalog under these names: N-(Pyrimidin-2-yl)-N-(thiophene-2-carbonyl)thiophene-2-carboxamide, 98%, 98%, CK1δ-IN-8. Offered by: Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 100 mg, 50 mg, 25 mg, 10 mg.
N-pyrimidin-2-yl-N-(thiophene-2-carbonyl)thiophene-2-carboxamide (CAS 438018-70-3) is a chemical compound with the molecular formula C14H9N3O2S2 and a molecular weight of 315.4 g/mol. IUPAC name: N-pyrimidin-2-yl-N-(thiophene-2-carbonyl)thiophene-2-carboxamide. InChIKey: LMQOLPKSRGGVJC-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O2S2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N-pyrimidin-2-yl-N-(thiophene-2-carbonyl)thiophene-2-carboxamide |
| InChIKey | LMQOLPKSRGGVJC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)N(C(=O)C2=CC=CS2)C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)