Products 438028-14-9

CAS 438028-14-9 is the registry number for 2-[(4-Butyl-8-methyl-2-oxo-2h-chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxypropanoic acid (CAS 438028-14-9) is a chemical compound with the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. IUPAC name: 2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxypropanoic acid. InChIKey: ZVRGYRUCBJTRFP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20O5
Molecular weight304.34 g/mol
IUPAC name2-(4-butyl-8-methyl-2-oxochromen-7-yl)oxypropanoic acid
InChIKeyZVRGYRUCBJTRFP-UHFFFAOYSA-N
SMILESCCCCC1=CC(=O)OC2=C1C=CC(=C2C)OC(C)C(=O)O

Computed by PubChem (NCBI)