Products 438049-36-6

CAS 438049-36-6 appears in our catalog under these names: 2,6-Difluoro-4-hydroxybenzyl alcohol, 95%, 2,6-Difluoro-4-hydroxybenzyl alcohol 95%, 2,6-Difluoro-4-hydroxybenzyl alcohol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 10g, 50g.

Structural formula: {0} (CAS {1})

3,5-difluoro-4-(hydroxymethyl)phenol (CAS 438049-36-6) is a chemical compound with the molecular formula C7H6F2O2 and a molecular weight of 160.12 g/mol. IUPAC name: 3,5-difluoro-4-(hydroxymethyl)phenol. InChIKey: RQMJWCOEDWMJLS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F2O2
Molecular weight160.12 g/mol
IUPAC name3,5-difluoro-4-(hydroxymethyl)phenol
InChIKeyRQMJWCOEDWMJLS-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)CO)F)O

Computed by PubChem (NCBI)