Products 438196-25-9
CAS 438196-25-9 is the registry number for Amb929. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]carbamothioylamino]benzoate (CAS 438196-25-9) is a chemical compound with the molecular formula C29H27N3O4S and a molecular weight of 513.6 g/mol. IUPAC name: methyl 4-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]carbamothioylamino]benzoate. InChIKey: PKDXMJXZEAJBBQ-UHFFFAOYSA-N.
| Molecular formula | C29H27N3O4S |
|---|---|
| Molecular weight | 513.6 g/mol |
| IUPAC name | methyl 4-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]carbamothioylamino]benzoate |
| InChIKey | PKDXMJXZEAJBBQ-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NC(=S)NC4=CC=C(C=C4)C(=O)OC |
Computed by PubChem (NCBI)