Products 438218-34-9

CAS 438218-34-9 is the registry number for 2-(3-(5-Methyl-2H-1,2,3,4-tetrazol-2-yl)adamantan-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[3-(5-methyltetrazol-2-yl)-1-adamantyl]acetic acid (CAS 438218-34-9) is a chemical compound with the molecular formula C14H20N4O2 and a molecular weight of 276.33 g/mol. IUPAC name: 2-[3-(5-methyltetrazol-2-yl)-1-adamantyl]acetic acid. InChIKey: CWCSWNJTYZOFSA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N4O2
Molecular weight276.33 g/mol
IUPAC name2-[3-(5-methyltetrazol-2-yl)-1-adamantyl]acetic acid
InChIKeyCWCSWNJTYZOFSA-UHFFFAOYSA-N
SMILESCC1=NN(N=N1)C23CC4CC(C2)CC(C4)(C3)CC(=O)O

Computed by PubChem (NCBI)