CAS 438218-40-7 is the registry number for 5-(2,6-Dichloro-phenoxymethyl)-furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(2,6-dichlorophenoxy)methyl]furan-2-carbaldehyde (CAS 438218-40-7) is a chemical compound with the molecular formula C12H8Cl2O3 and a molecular weight of 271.09 g/mol. IUPAC name: 5-[(2,6-dichlorophenoxy)methyl]furan-2-carbaldehyde. InChIKey: OVXPORWAFBOLRJ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O3 |
|---|---|
| Molecular weight | 271.09 g/mol |
| IUPAC name | 5-[(2,6-dichlorophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | OVXPORWAFBOLRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)