Products 438219-78-4

CAS 438219-78-4 is the registry number for 4-((4-Chloro-2-nitrophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid (CAS 438219-78-4) is a chemical compound with the molecular formula C14H10ClNO5 and a molecular weight of 307.68 g/mol. IUPAC name: 4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid. InChIKey: VCUCJKGNGZHZDB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClNO5
Molecular weight307.68 g/mol
IUPAC name4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid
InChIKeyVCUCJKGNGZHZDB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1COC2=C(C=C(C=C2)Cl)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)