CAS 438219-78-4 is the registry number for 4-((4-Chloro-2-nitrophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid (CAS 438219-78-4) is a chemical compound with the molecular formula C14H10ClNO5 and a molecular weight of 307.68 g/mol. IUPAC name: 4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid. InChIKey: VCUCJKGNGZHZDB-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO5 |
|---|---|
| Molecular weight | 307.68 g/mol |
| IUPAC name | 4-[(4-chloro-2-nitrophenoxy)methyl]benzoic acid |
| InChIKey | VCUCJKGNGZHZDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C=C2)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)