CAS 438220-93-0 is the registry number for 5-[(Pentachlorophenoxy)methyl]-2-furaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbaldehyde (CAS 438220-93-0) is a chemical compound with the molecular formula C12H5Cl5O3 and a molecular weight of 374.4 g/mol. IUPAC name: 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbaldehyde. InChIKey: FCNFVMJDFMVJDS-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | FCNFVMJDFMVJDS-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C=O)COC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)