CAS 438221-97-7 is the registry number for 5-(2-Chloro-4-fluorophenoxymethyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbaldehyde (CAS 438221-97-7) is a chemical compound with the molecular formula C12H8ClFO3 and a molecular weight of 254.64 g/mol. IUPAC name: 5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbaldehyde. InChIKey: ZIFBPWJYHBDSAL-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFO3 |
|---|---|
| Molecular weight | 254.64 g/mol |
| IUPAC name | 5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | ZIFBPWJYHBDSAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)OCC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)