CAS 438249-84-4 is the registry number for 4-Chloro-2-(2-pyridinyl)-6-(trifluoromethyl)-pyrimidine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-chloro-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine (CAS 438249-84-4) is a chemical compound with the molecular formula C10H5ClF3N3 and a molecular weight of 259.61 g/mol. IUPAC name: 4-chloro-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine. InChIKey: NPRHEFXGFBGECS-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3N3 |
|---|---|
| Molecular weight | 259.61 g/mol |
| IUPAC name | 4-chloro-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine |
| InChIKey | NPRHEFXGFBGECS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)