CAS 438474-97-6 is the registry number for (5-((2,5-Dichlorophenoxy)methyl)furan-2-yl)(4-methylpiperazin-1-yl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
[5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]-(4-methylpiperazin-1-yl)methanone (CAS 438474-97-6) is a chemical compound with the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.2 g/mol. IUPAC name: [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]-(4-methylpiperazin-1-yl)methanone. InChIKey: RMZVLXQPQCGFDK-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2O3 |
|---|---|
| Molecular weight | 369.2 g/mol |
| IUPAC name | [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]-(4-methylpiperazin-1-yl)methanone |
| InChIKey | RMZVLXQPQCGFDK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC=C(O2)COC3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)