CAS 438531-53-4 is the registry number for 6-Bromo-2-(4-chlorophenyl)-3-methyl-4-quinolinecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
6-bromo-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid (CAS 438531-53-4) is a chemical compound with the molecular formula C17H11BrClNO2 and a molecular weight of 376.6 g/mol. IUPAC name: 6-bromo-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid. InChIKey: JQFFTGQICZEUKB-UHFFFAOYSA-N.
| Molecular formula | C17H11BrClNO2 |
|---|---|
| Molecular weight | 376.6 g/mol |
| IUPAC name | 6-bromo-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid |
| InChIKey | JQFFTGQICZEUKB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)Br)N=C1C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)