CAS 4389-63-3 is the registry number for Isocymorcin. Offered by: TRC. Available pack sizes: 1g.
5-methyl-2-propan-2-ylbenzene-1,3-diol (CAS 4389-63-3) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 5-methyl-2-propan-2-ylbenzene-1,3-diol. InChIKey: TUWRZVAMHVWRER-UHFFFAOYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 5-methyl-2-propan-2-ylbenzene-1,3-diol |
| InChIKey | TUWRZVAMHVWRER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C(C)C)O |
Computed by PubChem (NCBI)