CAS 439095-66-6 is the registry number for 1-Chloro-5-fluoro-2-[(4-fluorobenzyl)oxy]-4-nitrobenzene. Offered by: Fluorochem. Available pack sizes: 25mg, 1g.
1-chloro-5-fluoro-2-[(4-fluorophenyl)methoxy]-4-nitrobenzene (CAS 439095-66-6) is a chemical compound with the molecular formula C13H8ClF2NO3 and a molecular weight of 299.65 g/mol. IUPAC name: 1-chloro-5-fluoro-2-[(4-fluorophenyl)methoxy]-4-nitrobenzene. InChIKey: SFPVMXVZFBGMGH-UHFFFAOYSA-N.
| Molecular formula | C13H8ClF2NO3 |
|---|---|
| Molecular weight | 299.65 g/mol |
| IUPAC name | 1-chloro-5-fluoro-2-[(4-fluorophenyl)methoxy]-4-nitrobenzene |
| InChIKey | SFPVMXVZFBGMGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C(=C2)[N+](=O)[O-])F)Cl)F |
Computed by PubChem (NCBI)