CAS 439109-62-3 is the registry number for 4-{2-((4-Chlorobenzyl)oxy)phenyl}-2-(4-pyridinyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 100mg.
4-[2-[(4-chlorophenyl)methoxy]phenyl]-2-pyridin-4-ylpyrimidine (CAS 439109-62-3) is a chemical compound with the molecular formula C22H16ClN3O and a molecular weight of 373.8 g/mol. IUPAC name: 4-[2-[(4-chlorophenyl)methoxy]phenyl]-2-pyridin-4-ylpyrimidine. InChIKey: JUZGZLRXPKIHBK-UHFFFAOYSA-N.
| Molecular formula | C22H16ClN3O |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | 4-[2-[(4-chlorophenyl)methoxy]phenyl]-2-pyridin-4-ylpyrimidine |
| InChIKey | JUZGZLRXPKIHBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NC=C2)C3=CC=NC=C3)OCC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)