CAS 440-17-5 appears in our catalog under these names: Trifluoperazine dihydrochloride, 98%, Trifluoperazine DiHCl, Trifluoperazine Hydrochloride, Trifluoperazine Dihydrochloride, >95% (HPLC), Trifluoperazine dihydrochloride. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer. Available pack sizes: 25g, 5g, 1g, on request, 10mg, 25mg, 50mg, 100mg.
10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine;dihydrochloride (CAS 440-17-5) is a chemical compound with the molecular formula C21H26Cl2F3N3S and a molecular weight of 480.4 g/mol. IUPAC name: 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine;dihydrochloride. InChIKey: BXDAOUXDMHXPDI-UHFFFAOYSA-N.
| Molecular formula | C21H26Cl2F3N3S |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine;dihydrochloride |
| InChIKey | BXDAOUXDMHXPDI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)