CAS 440123-65-9 appears in our catalog under these names: 2-Chloro-4-hydroxybenzoic acid monohydrate, 2-Chloro-4-hydroxybenzoic Acid Hydrate, >97%, >97%, 2-Chloro-4-hydroxybenzoic acid monohydra, te, 25 g, 2-Chloro-4-hydroxybenzoic acid monohydra, te, 50 g, 2-Chloro-4-hydroxybenzoic acid monohydra, te, 100 g. Offered by: Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 50g, 25g, 100g, 250g, 500g, 100mg, 250mg, 1g.
2-chloro-4-hydroxybenzoic acid;hydrate (CAS 440123-65-9) is a chemical compound with the molecular formula C7H7ClO4 and a molecular weight of 190.58 g/mol. IUPAC name: 2-chloro-4-hydroxybenzoic acid;hydrate. InChIKey: LVNLXWMDILTYQC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4 |
|---|---|
| Molecular weight | 190.58 g/mol |
| IUPAC name | 2-chloro-4-hydroxybenzoic acid;hydrate |
| InChIKey | LVNLXWMDILTYQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)C(=O)O.O |
Computed by PubChem (NCBI)