Products 440327-45-7
CAS 440327-45-7 is the registry number for 3’-O-Levulinyl-2’-deoxyadenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate (CAS 440327-45-7) is a chemical compound with the molecular formula C15H19N5O5 and a molecular weight of 349.34 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate. InChIKey: QMLRRPZLOJDYOV-HBNTYKKESA-N.
| Molecular formula | C15H19N5O5 |
|---|---|
| Molecular weight | 349.34 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate |
| InChIKey | QMLRRPZLOJDYOV-HBNTYKKESA-N |
| SMILES | CC(=O)CCC(=O)O[C@H]1C[C@@H](O[C@@H]1CO)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)