Products 440338-68-1
CAS 440338-68-1 is the registry number for Hit 14, 99.0%. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(oxolan-2-ylmethyl)-4-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]benzenesulfonamide (CAS 440338-68-1) is a chemical compound with the molecular formula C22H28N2O7S2 and a molecular weight of 496.6 g/mol. IUPAC name: N-(oxolan-2-ylmethyl)-4-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]benzenesulfonamide. InChIKey: JLXQRRFYTVITNY-UHFFFAOYSA-N.
| Molecular formula | C22H28N2O7S2 |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | N-(oxolan-2-ylmethyl)-4-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]benzenesulfonamide |
| InChIKey | JLXQRRFYTVITNY-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNS(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)S(=O)(=O)NCC4CCCO4 |
Computed by PubChem (NCBI)