CAS 440354-92-7 is the registry number for 4-(4,6-Diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylbenzenamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline (CAS 440354-92-7) is a chemical compound with the molecular formula C33H24N4 and a molecular weight of 476.6 g/mol. IUPAC name: 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline. InChIKey: SSTXLHRIIOMGDH-UHFFFAOYSA-N.
| Molecular formula | C33H24N4 |
|---|---|
| Molecular weight | 476.6 g/mol |
| IUPAC name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline |
| InChIKey | SSTXLHRIIOMGDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)