CAS 4405-08-7, appears in our catalog under these names: Metformin EP Impurity B, Metformin EP Impurity B (Monoguanyl Melamine), Guanylmelamine 97%, (4,6-DIAMINO-1,3,5-TRIAZINE-2-YL)GUANIDINE, 97%, 97%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 5g, 50mg, 100mg, 250mg, 1g.
2-(4,6-diamino-1,3,5-triazin-2-yl)guanidine (CAS 4405-08-7) is a chemical compound with the molecular formula C4H8N8 and a molecular weight of 168.16 g/mol. IUPAC name: 2-(4,6-diamino-1,3,5-triazin-2-yl)guanidine. InChIKey: QLVPICNVQBBOQP-UHFFFAOYSA-N.
| Molecular formula | C4H8N8 |
|---|---|
| Molecular weight | 168.16 g/mol |
| IUPAC name | 2-(4,6-diamino-1,3,5-triazin-2-yl)guanidine |
| InChIKey | QLVPICNVQBBOQP-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)N=C(N)N)N)N |
Computed by PubChem (NCBI)