CAS 4405-33-8 appears in our catalog under these names: (4-Nitrophenyl)trimethylsilane, 96%, (4-NItrophenyl)trimethylsilane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Trimethyl-(4-nitrophenyl)silane (CAS 4405-33-8) is a chemical compound with the molecular formula C9H13NO2Si and a molecular weight of 195.29 g/mol. IUPAC name: trimethyl-(4-nitrophenyl)silane. InChIKey: IJGJSNAIGBFOTK-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2Si |
|---|---|
| Molecular weight | 195.29 g/mol |
| IUPAC name | trimethyl-(4-nitrophenyl)silane |
| InChIKey | IJGJSNAIGBFOTK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)