CAS 4409-98-7 appears in our catalog under these names: PHTHALIC ACID, DIPOTASSIUM SALT, 98%, Di-potassium phthalate, 95%, DI–POTASSIUM PHTHALATE, Dipotassium phthalate, Potassium phthalate, 95%. Offered by: Sigma-Aldrich, Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25G, 100g, 5g, 500g.
Dipotassium;phthalate (CAS 4409-98-7) is a chemical compound with the molecular formula C8H4K2O4 and a molecular weight of 242.31 g/mol. IUPAC name: dipotassium;phthalate. InChIKey: GOMCKELMLXHYHH-UHFFFAOYSA-L.
| Molecular formula | C8H4K2O4 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | dipotassium;phthalate |
| InChIKey | GOMCKELMLXHYHH-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)