CAS 4411-25-0 appears in our catalog under these names: 1-Adamantyl isocyanate, 95%, 1-Adamantyl Isocyanate, 1-Adamantylisocyanate, 98%, 1–Adamantyl Isocyanate, 1-Adamantyl Isocyanate, >98.0%(GC). Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TCI. Available pack sizes: 5g, 1g, 250mg, 25mg, 50mg, 200mg, 25g.
1-isocyanatoadamantane (CAS 4411-25-0) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 1-isocyanatoadamantane. InChIKey: VBHCPGFCIQDXGZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 1-isocyanatoadamantane |
| InChIKey | VBHCPGFCIQDXGZ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)N=C=O |
Computed by PubChem (NCBI)