CAS 441715-93-1 appears in our catalog under these names: 6–fluoro–1–methyl–1H–indole–3–carbaldehyde, 6-Fluoro-1-methyl-1h-indole-3-carbaldehyde, 95%, 6-Fluoro-1-methyl-1H-indole-3-carbaldehyde 95%, 6-fluoro-1-methyl-1H-indole-3-carbaldehyde, 95+%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
6-fluoro-1-methylindole-3-carbaldehyde (CAS 441715-93-1) is a chemical compound with the molecular formula C10H8FNO and a molecular weight of 177.17 g/mol. IUPAC name: 6-fluoro-1-methylindole-3-carbaldehyde. InChIKey: IQKABDVTBNOGEW-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 6-fluoro-1-methylindole-3-carbaldehyde |
| InChIKey | IQKABDVTBNOGEW-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)F)C=O |
Computed by PubChem (NCBI)