CAS 441764-08-5 appears in our catalog under these names: 2-Deoxy-2-fluoro-D-glucose 6-Phosphate Dipotassium Salt, 2-Deoxy-2-fluoro-D-glucose 6-phosphate dipotassium, 2-Deoxy-2-fluoro-D-glucose 6-phosphate d, ipotassium, 1 mg, 2-Deoxy-2-fluoro-D-glucose 6-phosphate d, ipotassium, 2 mg, 2-Deoxy-2-fluoro-D-glucose 6-phosphate d, ipotassium, 5 mg. Offered by: TRC, Biosynth, Roth. Available pack sizes: 100mg, 2mg, 1mg, 5mg, 20mg, 10mg.
Dipotassium;[(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] phosphate (CAS 441764-08-5) is a chemical compound with the molecular formula C6H10FK2O8P and a molecular weight of 338.31 g/mol. IUPAC name: dipotassium;[(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] phosphate. InChIKey: OOLAPZQGXJMGKS-FAOVPRGRSA-L.
| Molecular formula | C6H10FK2O8P |
|---|---|
| Molecular weight | 338.31 g/mol |
| IUPAC name | dipotassium;[(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] phosphate |
| InChIKey | OOLAPZQGXJMGKS-FAOVPRGRSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)F)O)O)O)OP(=O)([O-])[O-].[K+].[K+] |
Computed by PubChem (NCBI)